CAS 31137-95-8

(2S)-4-methylpyrrolidine-2-carboxylic acid

Description:

(2S)-4-methylpyrrolidine-2-carboxylic acid, also known as L-proline, is a cyclic amino acid characterized by its five-membered ring structure containing a nitrogen atom. This compound features a carboxylic acid functional group and a methyl substituent at the 4-position of the pyrrolidine ring. As a chiral molecule, it exists in two enantiomeric forms, with the (S) configuration being the naturally occurring form. L-proline plays a crucial role in protein synthesis and is a key component of collagen, contributing to the structural integrity of various tissues. It is also involved in various metabolic pathways and can act as a precursor for other amino acids. The compound is typically white to off-white in appearance and is soluble in water, making it readily available for biological processes. Its unique structure imparts distinctive properties, such as the ability to stabilize protein structures through the formation of specific conformations. Additionally, L-proline has applications in pharmaceuticals and as a building block in organic synthesis.

Formula: C₆H₁₁NO₂

InChI: InChI=1/C6H11NO2/c1-4-2-5(6(8)9)7-3-4/h4-5,7H,2-3H2,1H3,(H,8,9)/t4?,5-/m0/s1

InChI key: VLDINRBTKBFNDD-TYSVMGFPSA-N

SMILES: CC1C[C@@H](C(=O)O)NC1

Synonyms:

• (2R,4R)-4-Methyl-2-pyroolidine carboxylic acid
• 4-Methyl-L-proline
• L-proline, 4-methyl-