CymitQuimica logo

CAS 3114-61-2

:

Phenol, 3-methoxy-2-nitro-

Description:
Phenol, 3-methoxy-2-nitro- is an organic compound characterized by the presence of a phenolic hydroxyl group, a methoxy group, and a nitro group attached to a benzene ring. Its molecular structure features a nitro group (-NO2) positioned at the 2-position and a methoxy group (-OCH3) at the 3-position relative to the hydroxyl group (-OH) on the aromatic ring. This compound is typically a yellow to orange solid and is soluble in organic solvents but has limited solubility in water. It exhibits properties typical of nitrophenols, including potential acidity due to the hydroxyl group and reactivity due to the electron-withdrawing nature of the nitro group. The presence of the methoxy group can influence its reactivity and stability, often making it less acidic than other nitrophenols. Phenol derivatives like this compound are of interest in various fields, including pharmaceuticals and agrochemicals, due to their biological activity and potential applications in synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C7H7NO4
InChI:InChI=1S/C7H7NO4/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,9H,1H3
InChI key:URFJTCWCTWGRBB-UHFFFAOYSA-N
SMILES:COC1=CC=CC(=C1[N+](=O)[O-])O
Found 4 products.