
CAS 31160-64-2
:Dihexyloctylphosphine oxide
Description:
Dihexyloctylphosphine oxide (DHOP) is an organophosphorus compound characterized by its phosphine oxide functional group, which contributes to its unique chemical properties. It typically appears as a colorless to pale yellow liquid and is known for its hydrophobic nature due to the long hydrocarbon chains (hexyl and octyl groups) attached to the phosphorus atom. This hydrophobicity makes DHOP useful as a surfactant and in various applications such as solvent extraction processes, particularly in the separation of metals. The presence of the phosphine oxide group imparts significant coordination ability, allowing it to interact with metal ions, which is beneficial in catalysis and material science. Additionally, DHOP exhibits thermal stability and can be used in high-temperature applications. Its low volatility and relatively high viscosity are also notable characteristics. Safety data indicates that, like many organophosphorus compounds, it should be handled with care to avoid potential health hazards. Overall, DHOP's unique structure and properties make it a valuable compound in both industrial and research settings.
Formula:C20H43OP
InChI:InChI=1S/C20H43OP/c1-4-7-10-13-14-17-20-22(21,18-15-11-8-5-2)19-16-12-9-6-3/h4-20H2,1-3H3
InChI key:InChIKey=XHRRUIJGMKIISX-UHFFFAOYSA-N
SMILES:P(CCCCCCCC)(CCCCCC)(CCCCCC)=O
Synonyms:- NSC 222429
- Dihexylmonooctylphosphine oxide
- Dihexyloctylphosphine oxide
- Phosphine oxide, dihexyloctyl-
- 1-Dihexylphosphoryloctane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

