
CAS 31160-66-4
:Hexyldioctylphosphine oxide
Description:
Hexyldioctylphosphine oxide, with the CAS number 31160-66-4, is an organophosphorus compound characterized by its phosphine oxide functional group. It typically appears as a colorless to pale yellow liquid and is known for its hydrophobic properties, making it soluble in organic solvents while being insoluble in water. This compound features a long hydrocarbon chain, which contributes to its surfactant properties and enhances its ability to interact with various organic materials. Hexyldioctylphosphine oxide is often utilized in the extraction and separation of metal ions, particularly in hydrometallurgy and analytical chemistry. Its ability to form stable complexes with metal ions is attributed to the presence of the phosphine oxide moiety, which can coordinate with metals. Additionally, it exhibits thermal stability and can be used in various industrial applications, including as a reagent in organic synthesis and as a stabilizer in polymer formulations. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity and environmental impact.
Formula:C22H47OP
InChI:InChI=1S/C22H47OP/c1-4-7-10-13-15-18-21-24(23,20-17-12-9-6-3)22-19-16-14-11-8-5-2/h4-22H2,1-3H3
InChI key:InChIKey=MKEFGIKZZDCMQC-UHFFFAOYSA-N
SMILES:P(CCCCCCCC)(CCCCCCCC)(CCCCCC)=O
Synonyms:- Dioctylhexylphosphine oxide
- Dioctylmonohexylphosphine oxide
- Phosphine oxide, hexyldioctyl-
- Hexyldioctylphosphine oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

