CAS 31164-13-3

1-acetyl-3-methylidene-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine

Description:

1-Acetyl-3-methylidene-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine is a complex organic compound characterized by its unique structure, which includes a pyrrolidine ring substituted with both an acetyl group and a nonafluoropentyl chain. The presence of the nonafluoropentyl group imparts significant hydrophobicity and chemical stability, making the compound potentially useful in various applications, including pharmaceuticals and materials science. The acetyl group contributes to the compound's reactivity, allowing for potential interactions in chemical reactions or biological systems. Additionally, the methylidene group introduces a double bond, which can influence the compound's stereochemistry and reactivity. The fluorinated alkyl chain enhances the compound's lipophilicity, which may affect its solubility and permeability in biological membranes. Overall, this compound's unique combination of functional groups and structural features makes it an interesting subject for further study in synthetic chemistry and potential applications in advanced materials or drug development.

Formula: C₁₂H₁₂F₉NO

InChI: InChI=1/C12H12F9NO/c1-6-4-22(7(2)23)5-8(6)3-9(13,14)10(15,16)11(17,18)12(19,20)21/h8H,1,3-5H2,2H3

SMILES: C=C1CN(CC1CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)C(=O)C

Synonyms:

• 1-[3-Methylene-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidin-1-yl]ethanone
• Ethanone, 1-[3-Methylene-4-(2,2,3,3,4,4,5,5,5-Nonafluoropentyl)-1-Pyrrolidinyl]-

N-Acetyl-3-methylene-4-(1H,1H-nonafluoropentyl)pyrrolidine

CAS: 31164-13-3

N-Acetyl-3-methylene-4-(1H,1H-nonafluoropentyl)pyrrolidine

Purity: ≥95%

Molecular weight: 357.22g/mol

Ref: 54-PC9215