CAS 31165-67-0
:1-[2-(benzyloxy)phenyl]ethanone
Description:
1-[2-(Benzyloxy)phenyl]ethanone, also known by its CAS number 31165-67-0, is an organic compound characterized by its ketone functional group and a substituted phenyl ring. This compound features a benzyloxy group attached to a phenyl ring, which contributes to its aromatic properties and potential reactivity. The presence of the ethanone moiety indicates that it has a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, including its reactivity in nucleophilic addition reactions. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic structure. Its unique structure may allow for various applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Additionally, the presence of the benzyloxy group can enhance the compound's stability and influence its electronic properties, making it a subject of interest in medicinal chemistry and materials science.
Formula:C15H14O2
InChI:InChI=1/C15H14O2/c1-12(16)14-9-5-6-10-15(14)17-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3
SMILES:CC(=O)c1ccccc1OCc1ccccc1
Synonyms:- Ethanone, 1-[2-(phenylmethoxy)phenyl]-
- 1-[2-(Benzyloxy)phenyl]ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-[2-(phenylmethoxy)phenyl]-
CAS:Formula:C15H14O2Purity:98%Color and Shape:SolidMolecular weight:226.27051-[2-(Benzyloxy)phenyl]ethan-1-one
CAS:1-[2-(Benzyloxy)phenyl]ethan-1-oneFormula:C15H14O2Purity:≥95%Color and Shape:SolidMolecular weight:226.27g/mol2-Benzyloxyacetophenone
CAS:2-Benzyloxyacetophenone is an efficient method for the synthesis of sodium hydrogen, alcohol group, and dietary proton. This compound has been shown to have inhibitory activity against Hl-60 cells, and it inhibits mitochondrial membrane potential in these cells. 2-Benzyloxyacetophenone also inhibits camp levels in Hl-60 cells. It has also been shown to have anticancer activity in vitro and in vivo. This compound is a β-unsaturated ketone that is derived from chalcones, which are known to be anticancer compounds.
Formula:C15H14O2Purity:Min. 95%Color and Shape:PowderMolecular weight:226.27 g/mol



