CAS 31168-10-2

3-(4-chlorophenoxy)pentane-2,4-dione

Description:

3-(4-Chlorophenoxy)pentane-2,4-dione, with the CAS number 31168-10-2, is an organic compound characterized by its diketone structure, featuring a pentane backbone with a chlorophenoxy substituent. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of the aromatic chlorophenyl group. The diketone functional groups contribute to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of the chlorine atom may enhance its biological activity or influence its interaction with other chemical species. Safety data should be consulted for handling, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, 3-(4-chlorophenoxy)pentane-2,4-dione is a compound of interest in both research and industrial contexts due to its unique chemical properties.

Formula: C₁₁H₁₁ClO₃

InChI: InChI=1/C11H11ClO3/c1-7(13)11(8(2)14)15-10-5-3-9(12)4-6-10/h3-6,11H,1-2H3

SMILES: CC(=O)C(C(=O)C)Oc1ccc(cc1)Cl

3-(4-chlorophenoxy)pentane-2,4-dione

CAS: 31168-10-2

3-(4-chlorophenoxy)pentane-2,4-dione

Purity: ≥95%

Molecular weight: 226.66g/mol

Ref: 54-OR29708