CymitQuimica logo

CAS 31169-27-4

:

Thieno[3,2-d]pyrimidine,7-bromo-4-chloro-

Description:
Thieno[3,2-d]pyrimidine, 7-bromo-4-chloro- is a heterocyclic compound characterized by a fused thieno and pyrimidine ring system. This compound features a bromine atom at the 7-position and a chlorine atom at the 4-position of the pyrimidine ring, which contributes to its unique reactivity and potential biological activity. The presence of these halogen substituents can influence the compound's electronic properties, solubility, and interaction with biological targets. Thieno[3,2-d]pyrimidines are of interest in medicinal chemistry due to their potential as pharmacophores in drug development, particularly in the fields of oncology and infectious diseases. The compound's structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used. Overall, thieno[3,2-d]pyrimidine, 7-bromo-4-chloro- represents a significant class of compounds with diverse applications in chemical research and pharmaceutical development.
Formula:C6H2BrClN2S
InChI:InChI=1S/C6H2BrClN2S/c7-3-1-11-5-4(3)9-2-10-6(5)8/h1-2H
InChI key:LJFZDPZIIKOATA-UHFFFAOYSA-N
SMILES:C1=C(C2=C(S1)C(=NC=N2)Cl)Br
Synonyms:
  • 7-Bromo-4-chlorothieno[3,2-d]pyrimidine
  • Thieno[3,2-d]pyrimidine, 7-bromo-4-chloro-
Found 4 products.