CAS 3117-02-0
:2,3-Dimethoxy-2,5-cyclohexadiene-1,4-dione
Description:
2,3-Dimethoxy-2,5-cyclohexadiene-1,4-dione, with the CAS number 3117-02-0, is an organic compound characterized by its unique bicyclic structure featuring two methoxy groups and a dione functional group. This compound is a derivative of cyclohexadiene, which contributes to its reactivity and stability. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The dione functionality suggests that it can participate in tautomeric shifts and may exhibit keto-enol tautomerism. Additionally, the compound's structure may allow for interesting interactions in biological systems or materials science applications. Its synthesis typically involves multi-step organic reactions, and it may be of interest in the development of dyes, pharmaceuticals, or as a building block in organic synthesis. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-11-7-5(9)3-4-6(10)8(7)12-2/h3-4H,1-2H3
InChI key:InChIKey=NADHCXOXVRHBHC-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(=O)C=CC1=O
Synonyms:- 2,3-Dimethoxy-1,4-Benzoquinone
- 2,3-Dimethoxy-2,5-cyclohexadiene-1,4-dione
- 2,3-Dimethoxybenzoquinone
- 2,3-Dimethoxycyclohexa-2,5-Diene-1,4-Dione
- 2,3-Dimethoxyquinone
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethoxy-
- NSC 56335
- Quinone, 2,3-dimethoxy-
- p-Benzoquinone, 2,3-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dimethoxycyclohexa-2,5-diene-1,4-dione
CAS:Formula:C8H8O4Color and Shape:SolidMolecular weight:168.14672,3-Dimethoxy-1,4-benzoquinone
CAS:2,3-Dimethoxy-1,4-benzoquinone is a chemical compound that belongs to the class of quinones. It is one of the most potent inhibitors of bacterial growth and has been shown to be effective against Gram-positive bacteria such as Staphylococcus aureus and Mycobacterium tuberculosis. 2,3-Dimethoxy-1,4-benzoquinone inhibits bacterial growth by interfering with fatty acid synthesis. This inhibition is due to its ability to react with methoxy groups on membrane lipids and nucleophilic attack on the carbon atom in the fatty acid chain. The binding constants for this interaction are relatively weak, which may explain why 2,3-dimethoxy-1,4-benzoquinone does not inhibit other types of cells like eukaryotic cells.Formula:C8H8O4Purity:Min. 95%Color and Shape:Red PowderMolecular weight:168.15 g/mol2,3-Diimethoxy-1,4-benzoquinone
CAS:Controlled ProductFormula:C8H8O4Color and Shape:NeatMolecular weight:168.147



