CAS 3117-38-2
:α-Phenoxybenzeneacetic acid
Description:
α-Phenoxybenzeneacetic acid, with the CAS number 3117-38-2, is an organic compound characterized by its phenoxy and acetic acid functional groups. It typically appears as a white to off-white solid and is soluble in organic solvents, though its solubility in water is limited. This compound exhibits properties typical of both phenolic and carboxylic acids, which may contribute to its reactivity and potential applications in organic synthesis. The presence of the phenoxy group can enhance its ability to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, α-Phenoxybenzeneacetic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point, boiling point, and specific reactivity can vary based on purity and environmental conditions. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity. Overall, α-Phenoxybenzeneacetic acid serves as a valuable compound in both academic research and industrial applications.
Formula:C14H12O3
InChI:InChI=1S/C14H12O3/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16)
InChI key:InChIKey=ABUKMOCUMIPDHV-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)(C(O)=O)C2=CC=CC=C2
Synonyms:- 2-Phenoxy-2-Phenylacetic Acid
- Acetic acid, phenoxyphenyl-
- Benzeneacetic Acid, Alpha-Phenoxy-
- Benzeneacetic acid, α-phenoxy-
- α-Phenoxybenzeneacetic acid
- α-Phenoxyphenylacetic acid
- Phenoxy(phenyl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Phenoxy-2-phenylacetic acid
CAS:<p>2-Phenoxy-2-phenylacetic acid is an immunosuppressant, which has been shown to bind to the glucocorticoid receptor. It binds in a similar manner to other drugs that are used for the treatment of inflammatory bowel disease and congestive heart failure. 2-Phenoxy-2-phenylacetic acid also inhibits the activity of pparγ, which is a nuclear receptor that regulates lipid metabolism. This drug has been shown to have anti-inflammatory effects in mice by inhibiting lipopolysaccharide (LPS) induced inflammation. 2-Phenoxy-2-phenylacetic acid has also been shown to inhibit NFκB activation through inhibition of diazonium salt or diphenyl ether, both of which are electrophiles.</p>Formula:C14H12O3Purity:Min. 95%Molecular weight:228.24 g/mol


