CAS 3117-51-9
:2-(1-Naphthyl)propionic acid
Description:
2-(1-Naphthyl)propionic acid, commonly known as naproxen, is a nonsteroidal anti-inflammatory drug (NSAID) characterized by its ability to reduce inflammation, pain, and fever. It features a propionic acid structure with a naphthyl group, which contributes to its pharmacological properties. The compound is typically a white to off-white crystalline powder, exhibiting moderate solubility in water and higher solubility in organic solvents. Its molecular formula is C15H14O2, and it has a molecular weight that reflects its complex structure. Naproxen acts by inhibiting cyclooxygenase enzymes (COX-1 and COX-2), leading to decreased synthesis of prostaglandins, which are mediators of inflammation and pain. This compound is widely used in the treatment of various conditions, including arthritis, menstrual pain, and other inflammatory disorders. Additionally, it has a relatively long half-life, allowing for less frequent dosing compared to some other NSAIDs. As with all medications, it is important to consider potential side effects and contraindications when using naproxen.
Formula:C13H12O2
InChI:InChI=1S/C13H12O2/c1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,1H3,(H,14,15)
InChI key:InChIKey=VKCNNDPZFOVURD-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- (±)-2-(α-Naphthyl)propionic acid
- 1-Naphthaleneacetic acid, alpha-methyl-
- 1-Naphthaleneacetic acid, α-methyl-
- 2-(1-Naphthyl)propionic acid
- a-Methyl-1-naphthaleneacetic acid
- α-(1-Naphthyl)propionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
a-Methyl-1-naphthaleneacetic acid
CAS:Formula:C13H12O2Purity:97%Color and Shape:SolidMolecular weight:200.2332a-methyl-1-naphthaleneacetic acid
CAS:<p>a-methyl-1-naphthaleneacetic acid is a metabolite of butyric acid that has been shown to have anticoagulant properties. It is also a precursor for the synthesis of naphthoic acid, which can be used to make coatings and inks. It is an anti-inflammatory agent that has been shown to inhibit inflammatory bowel disease and cancer. The mechanism of action is not known, but it may involve its ability to inhibit the synthesis of proinflammatory cytokines and tumor necrosis factor (TNF).</p>Formula:C13H12O2Purity:Min. 95%Molecular weight:200.23 g/mol


