CAS 31170-78-2

5,6-Dihydro-7H-cyclopenta[b]pyridin-7-one

Description:

5,6-Dihydro-7H-cyclopenta[b]pyridin-7-one, with the CAS number 31170-78-2, is a bicyclic organic compound that features a fused cyclopentane and pyridine ring system. This compound is characterized by its nitrogen-containing heterocycle, which contributes to its potential biological activity. The presence of the carbonyl group (ketone) at the 7-position enhances its reactivity and may influence its interactions with biological targets. Typically, compounds of this class may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The structure allows for potential hydrogen bonding and π-π interactions, which can be crucial for binding to biological macromolecules. Additionally, the compound's stereochemistry and electronic properties can significantly affect its solubility, stability, and overall reactivity. While specific applications and biological activities may vary, compounds like 5,6-Dihydro-7H-cyclopenta[b]pyridin-7-one are often explored for their roles in drug development and synthesis of novel therapeutic agents.

Formula: C₈H₇NO

InChI: InChI=1/C8H7NO/c10-7-4-3-6-2-1-5-9-8(6)7/h1-2,5H,3-4H2

SMILES: c1cc2CCC(=O)c2nc1

Synonyms:

• 7H-cyclopenta[b]pyridin-7-one, 5,6-dihydro-
• 5H-cyclopenta[b]pyridin-7(6H)-one

5H-Cyclopenta[b]pyridin-7(6H)-one

CAS: 31170-78-2

Formula: C₈H₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 133.1473

Ref: IN-DA003MA2

5,6-Dihydro-7h-cyclopenta[b]pyridin-7-one

CAS: 31170-78-2

5,6-Dihydro-7h-cyclopenta[b]pyridin-7-one

Purity: 97%

Molecular weight: 133.15g/mol

Ref: 54-OR951739

5H-Cyclopenta[b]pyridin-7(6H)-one

CAS: 31170-78-2

Formula: C₈H₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 133.15

Ref: 10-F093180

5,6-Dihydro-7H-cyclopenta[b]pyridin-7-one

Controlled Product

CAS: 31170-78-2

Formula: C₈H₇NO

Color and Shape: Neat

Molecular weight: 133.147

Ref: TR-D448805