CAS 31178-70-8
:α-D-Xylopyranose
Description:
α-D-Xylopyranose is a six-membered cyclic form of the sugar xylose, which is a pentose monosaccharide. It is characterized by its pyranose ring structure, where the hydroxyl (-OH) groups are positioned around the ring, influencing its reactivity and interactions. This compound is an anomer of D-xylose, specifically the α-anomer, meaning that the hydroxyl group on the anomeric carbon (C1) is oriented in the axial position relative to the ring. α-D-Xylopyranose is soluble in water, reflecting its polar nature due to multiple hydroxyl groups, which can form hydrogen bonds with water molecules. It plays a significant role in various biological processes and is involved in the metabolism of carbohydrates. Additionally, it can participate in glycosidic bond formation, contributing to the structure of polysaccharides. Its CAS number, 31178-70-8, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, α-D-Xylopyranose is an important sugar in both biochemical and industrial contexts.
Formula:C5H10O5
InChI:InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1
InChI key:InChIKey=SRBFZHDQGSBBOR-LECHCGJUSA-N
SMILES:O[C@@H]1[C@@H](O)[C@@H](O)OC[C@H]1O
Synonyms:- (D)-Xylose
- Holzzucker
- Losan
- Xylopyranose, α-<span class="text-smallcaps">D</span>-
- Xylose, D-
- α-<span class="text-smallcaps">D</span>-Xylopyranose
- α-<span class="text-smallcaps">D</span>-Xylose
- α-Xylose
- α-D-Xylopyranose
- α-D-Xylose
- Xylopyranose, α-D-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
