CAS 31181-60-9

2-Methyl-5-(methylthio)pyridine

Description:

2-Methyl-5-(methylthio)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methyl group and a methylthio group attached to the pyridine ring, specifically at the 2 and 5 positions, respectively. The presence of the methylthio group contributes to its unique chemical properties, including potential reactivity and solubility characteristics. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its applications in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, 2-Methyl-5-(methylthio)pyridine may exhibit specific odor characteristics, often associated with sulfur-containing compounds. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₉NS

InChI: InChI=1S/C7H9NS/c1-6-3-4-7(9-2)5-8-6/h3-5H,1-2H3

InChI key: InChIKey=BKPOKYNAGIKTMC-UHFFFAOYSA-N

SMILES: S(C)C=1C=CC(C)=NC1

Synonyms:

• 2-Methyl-5-(methylthio)pyridine
• 2-Picoline, 5-(methylthio)-
• 2-Methyl-5-(methylsulfanyl)pyridine
• Pyridine, 2-methyl-5-(methylthio)-