CAS 31181-86-9

5-(Dimethylamino)-2-pyridinemethanol

Description:

5-(Dimethylamino)-2-pyridinemethanol, with the CAS number 31181-86-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and a dimethylamino group (-N(CH3)2) attached to the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The dimethylamino group enhances its basicity and can participate in various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Its structural characteristics allow for potential applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-10(2)8-4-3-7(6-11)9-5-8/h3-5,11H,6H2,1-2H3

InChI key: InChIKey=CTMWYFUKKQAPTI-UHFFFAOYSA-N

SMILES: N(C)(C)C=1C=CC(CO)=NC1

Synonyms:

• 2-Pyridinemethanol, 5-(dimethylamino)-
• [5-(Dimethylamino)pyridin-2-yl]methanol
• 5-(Dimethylamino)-2-pyridinemethanol