CAS 3119-15-1
:3-Amino-2,4,6-triiodobenzoic acid
Description:
3-Amino-2,4,6-triiodobenzoic acid, with the CAS number 3119-15-1, is an organic compound characterized by the presence of three iodine atoms and an amino group attached to a benzoic acid structure. This compound is a derivative of benzoic acid, where the iodine substituents are located at the 2, 4, and 6 positions of the aromatic ring, while the amino group is positioned at the 3 position. The presence of multiple iodine atoms contributes to its high molecular weight and unique physical properties, such as increased density and potential for enhanced solubility in certain solvents. The amino group imparts basic characteristics, allowing the compound to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the triiodinated structure may exhibit interesting biological activities, making it of interest in medicinal chemistry and radiology. Overall, 3-Amino-2,4,6-triiodobenzoic acid is notable for its complex structure and potential applications in various scientific fields.
Formula:C7H4I3NO2
InChI:InChI=1S/C7H4I3NO2/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1H,11H2,(H,12,13)
InChI key:InChIKey=QMQFFHSJUJDRPG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(I)C(N)=C(I)C=C1I
Synonyms:- 2,4,6-Triiodo-3-aminobenzoic acid
- 3-Amino-2,4,6-Triiodobenzoate
- Benzoic Acid, 3-Amino-2,4,6-Triiodo-
- NSC 60105
- Sodium 3-Amino-2,4,6-Triiodobenzoate
- 3-Amino-2,4,6-triiodobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Amino-2,4,6-triiodobenzoic acid, 99% (dry wt.), water <4%
CAS:3-Amino-2,4,6-triiodobenzoic acid is used to prepare polymeric hydrogel based particles used in vascular embolization. It can be used in agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documFormula:C7H3I3NNaO2Purity:99%Color and Shape:White to pale cream to pale brown, PowderMolecular weight:536.813-Amino-2,4,6-triiodobenzoic Acid
CAS:Aromatic amino-acids and their esters, other than those containing more than one kind of oxygen function, not elsewhere specified or includedFormula:C7H4I3NO2Color and Shape:Light Yellow Amorphous PowderMolecular weight:514.737623-Amino-2,4,6-triiodobenzoic acid
CAS:Formula:C7H4I3NO2Purity:98%Color and Shape:SolidMolecular weight:514.82563-Amino-2,4,6-triiodobenzoic Acid
CAS:Controlled ProductFormula:C7H4I3NO2Color and Shape:NeatMolecular weight:514.833-Amino-2,4,6-triiodobenzoic acid
CAS:3-Amino-2,4,6-triiodobenzoic acid (3AIBA) is a chemical compound that is used as a contrast agent for medical imaging. It has been shown to be useful in the diagnosis of bladder cancer, and is used in the embolization of renal artery and ureteral calculi. 3AIBA functions by binding to the antigen binding sites on the tumor cells and allows visualization with X-rays. It has also been shown to be effective in reducing blood flow in tumors by blocking blood vessels with its cationic monomer. 3AIBA binds to the phosphate groups on DNA and causes crosslinking, which prevents DNA polymerase from binding with DNA. This inhibits DNA synthesis and cell division.Formula:C7H4I3NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:514.83 g/mol







