CAS 31197-54-3
:1,1,5,6-tetramethyl-1,2,3,4-tetrahydronaphthalene
Description:
1,1,5,6-Tetramethyl-1,2,3,4-tetrahydronaphthalene, with the CAS number 31197-54-3, is an organic compound characterized by its polycyclic structure, which consists of a naphthalene core that has been saturated and substituted with four methyl groups. This compound is a colorless to pale yellow liquid at room temperature and is known for its relatively high boiling point and low volatility. It exhibits hydrophobic properties, making it insoluble in water but soluble in organic solvents. The presence of multiple methyl groups contributes to its steric bulk, influencing its reactivity and interactions with other chemical species. It is often used as a solvent or as a component in various chemical formulations. Additionally, due to its structure, it may exhibit interesting physical and chemical properties, such as stability under certain conditions and potential applications in materials science or organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H20
InChI:InChI=1/C14H20/c1-10-7-8-13-12(11(10)2)6-5-9-14(13,3)4/h7-8H,5-6,9H2,1-4H3
SMILES:Cc1ccc2c(CCCC2(C)C)c1C
Synonyms:- 1,2,3,4-Tetrahydro-1,1,5,6-tetramethylnaphthalene
- Naphthalene, 1,2,3,4-Tetrahydro-1,1,5,6-Tetramethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methylionene
CAS:Methylionene is a natural product for research related to life sciences. The catalog number is TN4559 and the CAS number is 31197-54-3.Formula:C14H20Purity:98%Color and Shape:SolidMolecular weight:188.31Methylionene
CAS:Methylionene is a chemical compound classified as a synthetic fragrance ingredient, which is derived from petrochemical sources. It operates by interacting with olfactory receptors to produce a distinctive scent, often described as a versatile, floral aroma with woody undertones. This mode of action primarily involves the activation of sensory pathways that contribute to the perception of its odor profile.Formula:C14H20Purity:Min. 95%Molecular weight:188.31 g/mol


