CAS 312-31-2
:1-Fluoro-4-(phenylsulfonyl)benzene
Description:
1-Fluoro-4-(phenylsulfonyl)benzene, with the CAS number 312-31-2, is an organic compound characterized by the presence of a fluorine atom and a phenylsulfonyl group attached to a benzene ring. This compound features a fluorine substituent at the para position relative to the sulfonyl group, which can influence its reactivity and physical properties. It is typically a colorless to pale yellow solid at room temperature, exhibiting moderate solubility in organic solvents such as acetone and dichloromethane. The sulfonyl group contributes to its potential as a sulfonamide precursor, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, which are important factors in drug design. Additionally, 1-Fluoro-4-(phenylsulfonyl)benzene may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atom, affecting its reactivity in electrophilic aromatic substitution reactions.
Formula:C12H9FO2S
InChI:InChI=1S/C12H9FO2S/c13-10-6-8-12(9-7-10)16(14,15)11-4-2-1-3-5-11/h1-9H
InChI key:InChIKey=MONGUDQJUIVFPI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(F)C=C1)C2=CC=CC=C2
Synonyms:- 1-Fluoro-4-(Phenylsulfonyl)Benzene
- 1-Fluoro-4-(phenylsulphonyl)benzene
- 4-(Phenylsulfonyl)fluorobenzene
- 4-Fluorodiphenyl sulfone
- 4-Fluorophenyl phenyl sulfone
- Benzene, 1-fluoro-4-(phenylsulfonyl)-
- Sulfone, p-fluorophenyl phenyl
- p-Fluorophenyl phenyl sulfone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.