CAS 3122-88-1
:Eucalyptin
Description:
Eucalyptin, with the CAS number 3122-88-1, is a chemical compound derived from eucalyptus oil, primarily known for its potential therapeutic properties. It is classified as a glycoside, specifically a flavonoid glycoside, which contributes to its biological activity. Eucalyptin exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. This compound is often studied for its potential anti-inflammatory and antimicrobial effects, making it of interest in both pharmacological and cosmetic applications. Eucalyptin is typically soluble in organic solvents and may have limited solubility in water, which is a common characteristic of many flavonoids. Its structure includes a sugar moiety attached to a flavonoid backbone, influencing its solubility and biological interactions. Overall, eucalyptin represents a significant area of research due to its natural origin and potential health benefits, although further studies are needed to fully elucidate its mechanisms of action and therapeutic efficacy.
Formula:C19H18O5
InChI:InChI=1S/C19H18O5/c1-10-17(21)16-14(20)9-15(12-5-7-13(22-3)8-6-12)24-19(16)11(2)18(10)23-4/h5-9,21H,1-4H3
InChI key:InChIKey=NHMMAMIRMITGRD-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(O)C(C)=C1OC)C(=O)C=C(O2)C3=CC=C(OC)C=C3
Synonyms:- 4H-1-Benzopyran-4-one, 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-
- 4′,7-Dimethoxy-6,8-dimethyl-5-hydroxyflavone
- 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4H-1-benzopyran-4-one
- 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4H-chromen-4-one
- Eucalyptin
- Flavone, 5-hydroxy-4′,7-dimethoxy-6,8-dimethyl-
- 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4-benzopyrone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Hydroxy-7,4'-dimethoxy-6,8-dimethylflavone
CAS:Formula:C19H18O5Color and Shape:SolidMolecular weight:326.3432Eucalyptin
CAS:Eucalyptin: Antioxidant, antimicrobial, inhibits HGF/c-Met axis, MIC 1.0-31 mg/L against 7 microbes.Formula:C19H18O5Purity:98%Color and Shape:SolidMolecular weight:326.345-Hydroxy-7,4'-dimethoxy-6,8-dimethylflavone
CAS:5-Hydroxy-7,4'-dimethoxy-6,8-dimethylflavone is a bioactive flavonoid compound, which is naturally derived from certain plant sources. As a type of flavone, this compound is notable for its polyphenolic skeleton that contributes to notable biological properties. Its mode of action primarily involves modulating various enzymatic pathways and cellular signaling processes due to its structural ability to interact with biomolecules like enzymes and receptors. This interaction can lead to a range of biological effects, including antioxidant and anti-inflammatory activities.Formula:C19H18O5Purity:Min. 95%Molecular weight:326.34 g/mol5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4H-chromen-4-one
CAS:Controlled ProductApplications 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4H-chromen-4-one (cas# 3122-88-1) is a useful research chemical.
Formula:C19H18O5Color and Shape:NeatMolecular weight:326.34




