CAS 31224-82-5
:5-(trifluoromethyl)pyridine-2-carbaldehyde
Description:
5-(Trifluoromethyl)pyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 5-position of the pyridine ring significantly influences its chemical properties, enhancing its lipophilicity and reactivity. The aldehyde functional group (-CHO) at the 2-position contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and conditions. It is known for its potential applications in medicinal chemistry, where the trifluoromethyl group can improve biological activity and metabolic stability. Additionally, due to the presence of both the electron-withdrawing trifluoromethyl group and the aldehyde, it exhibits unique reactivity patterns, making it a valuable building block in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C7H4F3NO
InChI:InChI=1/C7H4F3NO/c8-7(9,10)5-1-2-6(4-12)11-3-5/h1-4H
SMILES:c1cc(C=O)ncc1C(F)(F)F
Synonyms:- 2-Pyridinecarboxaldehyde, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-2-pyridinecarboxyaldehyde
- 5-(Trifluoromethyl)pyridine-2-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(Trifluoromethyl)pyridine-2-carboxaldehyde, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H4F3NOPurity:95%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:175.115-Trifluoromethyl-pyridine-2-carbaldehyde
CAS:Formula:C7H4F3NOPurity:95%Color and Shape:SolidMolecular weight:175.1080Ref: IN-DA00C1TQ
1g57.00€5g160.00€10g219.00€25g661.00€50gTo inquire100gTo inquire250gTo inquire500gTo inquire100mg26.00€250mg34.00€5-(Trifluoromethyl)-2-pyridinecarboxyaldehyde
CAS:5-(Trifluoromethyl)-2-pyridinecarboxyaldehydePurity:95%Color and Shape:SolidMolecular weight:175.11g/mol5-(Trifluoromethyl)-pyridine-2-carboxaldehyde
CAS:Formula:C7H4F3NOPurity:95%Color and Shape:White crystalline solidMolecular weight:175.11



