CAS 312303-93-8

[3-(Methylsulfonyl)phenyl]hydrazine

Description:

[3-(Methylsulfonyl)phenyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that has a methylsulfonyl substituent. This compound typically exhibits properties associated with both hydrazines and sulfonyl groups, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The methylsulfonyl group enhances the compound's solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the sulfonyl group can impart unique electronic properties, potentially affecting the compound's reactivity and stability. As with many hydrazine derivatives, [3-(Methylsulfonyl)phenyl]hydrazine may exhibit toxicity and should be handled with care in laboratory settings. Its applications could range from pharmaceuticals to agrochemicals, depending on its specific interactions and biological effects. Always consult safety data sheets and relevant literature for detailed handling and usage guidelines.

Formula: C₇H₁₀N₂O₂S

InChI: InChI=1S/C7H10N2O2S/c1-12(10,11)7-4-2-3-6(5-7)9-8/h2-5,9H,8H2,1H3

InChI key: InChIKey=SZPJJHUFWHTSON-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC(NN)=CC=C1

Synonyms:

• (3-Methanesulfonylphenyl)hydrazine
• [3-(Methylsulfonyl)phenyl]hydrazine
• Hydrazine, [3-(methylsulfonyl)phenyl]-
• Hydrazine, [3-(Methylsulfonyl)Phenyl]-

(3-Methanesulfonylphenyl)hydrazine

CAS: 312303-93-8

Versatile small molecule scaffold

Formula: C₇H₁₀N₂O₂S

Purity: Min. 95%

Molecular weight: 186.23 g/mol

Ref: 3D-MMA30393