CAS 312309-43-6

(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetic acid

Description:

(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetic acid is a chemical compound characterized by its pyrazole ring structure, which is substituted with a bromine atom and two methyl groups at specific positions. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methyl groups provide steric hindrance, which can affect the compound's interactions with biological targets. This substance is typically used in research and development, particularly in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various potential applications, including as a building block in organic synthesis. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions, making it essential to consider these factors in practical applications. Overall, (4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetic acid exemplifies the complexity and versatility of pyrazole derivatives in chemical research.

Formula: C₇H₉BrN₂O₂

InChI: InChI=1/C7H9BrN2O2/c1-4-7(8)5(2)10(9-4)3-6(11)12/h3H2,1-2H3,(H,11,12)

SMILES: Cc1c(c(C)n(CC(=O)O)n1)Br

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-bromo-3,5-dimethyl-
• (4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetic acid

(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)acetic acid

CAS: 312309-43-6

Formula: C₇H₉BrN₂O₂

Molecular weight: 233.0626

Ref: IN-DA00BDKL

(4-Bromo-3,5-dimethyl-pyrazol-1-yl)-acetic acid

CAS: 312309-43-6

Formula: C₇H₉BrN₂O₂

Purity: 95.0%

Molecular weight: 233.065

Ref: 10-F027877