CAS 312318-48-2
:1-(6-chloropyridazin-3-yl)azepane
Description:
1-(6-Chloropyridazin-3-yl)azepane is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a seven-membered azepane ring. The presence of a chlorine atom at the 6-position of the pyridazine contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in both the pyridazine and azepane rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting pharmacological properties. The azepane ring can influence the compound's conformational flexibility, which may affect its interaction with biological targets. Additionally, the chlorine substituent can enhance lipophilicity and influence the compound's solubility and permeability. Overall, 1-(6-chloropyridazin-3-yl)azepane represents a class of compounds that may be of interest for further research in drug discovery and development.
Formula:C10H14ClN3
InChI:InChI=1/C10H14ClN3/c11-9-5-6-10(13-12-9)14-7-3-1-2-4-8-14/h5-6H,1-4,7-8H2
SMILES:C1CCCN(CC1)c1ccc(Cl)nn1
Synonyms:- 1-(6-Chloro-pyridazin-3-yl)-azepane
- 1H-Azepine, 1-(6-chloro-3-pyridazinyl)hexahydro-
- 1-(6-Chloropyridazin-3-yl)azepane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
