
CAS 31232-26-5
:9,10-Dihydro-10-(1-methyl-4-piperidinylidene)-9-anthracenol
Description:
9,10-Dihydro-10-(1-methyl-4-piperidinylidene)-9-anthracenol, with the CAS number 31232-26-5, is a chemical compound that belongs to the class of anthracene derivatives. This substance features a polycyclic aromatic structure, characterized by its fused benzene rings, which contributes to its stability and potential electronic properties. The presence of a piperidine moiety introduces basic nitrogen functionality, which can influence its reactivity and solubility in various solvents. The compound is typically studied for its potential applications in organic electronics, such as in organic light-emitting diodes (OLEDs) and organic photovoltaics, due to its ability to facilitate charge transport. Additionally, the presence of hydroxyl (-OH) and alkyl substituents can affect its intermolecular interactions and overall physical properties, including melting point and solubility. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and environmental impact of this compound may not be fully characterized.
Formula:C20H21NO
InChI:InChI=1S/C20H21NO/c1-21-12-10-14(11-13-21)19-15-6-2-4-8-17(15)20(22)18-9-5-3-7-16(18)19/h2-9,20,22H,10-13H2,1H3
InChI key:InChIKey=HLBRHTFSMMEHPK-UHFFFAOYSA-N
SMILES:OC1C=2C(C(C=3C1=CC=CC3)=C4CCN(C)CC4)=CC=CC2
Synonyms:- Danitracen
- WA 335BS
- 9,10-Dihydro-10-(1-methyl-4-piperidinylidene)-9-anthracenol
- 9-Anthracenol, 9,10-dihydro-10-(1-methyl-4-piperidinylidene)-
- 9-Anthrol, 9,10-dihydro-10-(1-methyl-4-piperidylidene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Danitracen
CAS:Danitracen is a biochemical.Formula:C20H21NOColor and Shape:SolidMolecular weight:291.39
