CAS 312325-73-8

(4-bromopyridin-2-yl)acetonitrile

Description:

(4-Bromopyridin-2-yl)acetonitrile is an organic compound characterized by its pyridine ring structure substituted with a bromine atom and an acetonitrile functional group. The presence of the bromine atom at the 4-position of the pyridine ring enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The acetonitrile group contributes to its polar nature, which can influence solubility and interaction with other molecules. This compound typically appears as a colorless to light yellow liquid or solid, depending on its physical state at room temperature. Its molecular structure allows for potential participation in nucleophilic substitution reactions, and it may also serve as a building block for more complex organic molecules. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, (4-bromopyridin-2-yl)acetonitrile is a versatile compound in synthetic organic chemistry.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-6-2-4-10-7(5-6)1-3-9/h2,4-5H,1H2

SMILES: C(C#N)c1cc(ccn1)Br

Synonyms:

• 2-Pyridineacetonitrile, 4-Bromo-

2-CyanoMethyl-4-broMopyridine

CAS: 312325-73-8

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA00BG32

2-(4-Bromopyridin-2-yl)acetonitrile

CAS: 312325-73-8

2-(4-Bromopyridin-2-yl)acetonitrile

Purity: 98%

Molecular weight: 197.03g/mol

Ref: 54-OR76404

2-(4-Bromopyridin-2-yl)acetonitrile

CAS: 312325-73-8

Formula: C₇H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.035

Ref: 10-F326329