CAS 31241-19-7
:2,3,3-Trimethyl-5-Methoxy-indolenine
Description:
2,3,3-Trimethyl-5-methoxy-indolenine is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular indolenine derivative features three methyl groups at the 2 and 3 positions and a methoxy group at the 5 position, contributing to its unique chemical properties. The presence of these substituents influences its electronic characteristics, making it potentially useful in various applications, including organic synthesis and as a dye or pigment. The compound is typically characterized by its solubility in organic solvents and may exhibit distinct UV-Vis absorption properties due to its conjugated system. Additionally, it may participate in various chemical reactions, such as electrophilic substitutions, owing to the reactivity of the indole nitrogen and the electron-donating effects of the methoxy group. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C12H15NO
InChI:InChI=1/C12H15NO/c1-8-12(2,3)10-7-9(14-4)5-6-11(10)13-8/h5-7H,1-4H3
SMILES:CC1=Nc2ccc(cc2C1(C)C)OC
Synonyms:- 5-Methoxy-2,3,3-Trimethyl-3H-INDOLE
- 2,3,3-Trimethyl-5-Methoxy-3H-INDOLE
- 2,3,3-Trimethyl-5-methoxyindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3H-Indole, 5-methoxy-2,3,3-trimethyl-
CAS:Formula:C12H15NOPurity:98%Color and Shape:SolidMolecular weight:189.25362,3,3-Trimethyl-5-methoxy-3H-indole
CAS:2,3,3-Trimethyl-5-methoxy-3H-indolePurity:99%Color and Shape:PowderMolecular weight:189.25g/mol5-Methoxy-2,3,3-trimethyl-3H-indole
CAS:5-Methoxy-2,3,3-trimethyl-3H-indole is a chemical building block that can be used in the synthesis of other compounds. It's a versatile intermediate that can be used as a reagent or reaction component. As a speciality chemical, it has high quality and purity. 5-Methoxy-2,3,3-trimethyl-3H-indole is an organic compound that belongs to the group of aliphatic amines. Its CAS number is 31241-19-7.
Formula:C12H15NOMolecular weight:189.26 g/mol2,3,3-Trimethyl 5-methoxy indolenine
CAS:2,3,3-Trimethyl 5-methoxy indolenine (TMMI) is a fluorescent probe that has been used in photodynamic therapy. TMMI is chemically stable and has an unsymmetrical heterocycle with optical properties that allow it to be excited by green light at wavelengths of 540 nm. TMMI can be used to image hypoxic regions of the brain. This molecule has also been used as an enhancement agent for neovascularization and angiography. TMMI can be synthesized using mesoporous silica nanoparticles and halogens such as chlorine or bromine.Formula:C12H15NOPurity:Min. 95%Molecular weight:189.25 g/mol



