CAS 3125-71-1
:3-Acetylphenyl isothiocyanate
Description:
3-Acetylphenyl isothiocyanate is an organic compound characterized by the presence of both an isothiocyanate functional group and an acetyl group attached to a phenyl ring. Its molecular structure features a phenyl ring substituted at the 3-position with an acetyl group and an isothiocyanate group, which is known for its reactivity and ability to form thiourea derivatives. This compound typically appears as a yellow to brown liquid and has a distinctive pungent odor, characteristic of isothiocyanates. It is soluble in organic solvents but has limited solubility in water. 3-Acetylphenyl isothiocyanate is of interest in various fields, including medicinal chemistry and agricultural science, due to its potential biological activities, including antimicrobial and anticancer properties. As with many isothiocyanates, it may exhibit toxicity, necessitating careful handling and appropriate safety measures during use. Its reactivity allows it to participate in various chemical reactions, making it a valuable intermediate in organic synthesis.
Formula:C9H7NOS
InChI:InChI=1/C9H7NOS/c1-7(11)8-3-2-4-9(5-8)10-6-12/h2-5H,1H3
SMILES:CC(=O)c1cccc(c1)N=C=S
Synonyms:- 3-Isothiocyanatoacetophenone
- 1-(3-Isothiocyanatophenyl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Acetylphenyl isothiocyanate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H7NOSPurity:97%Color and Shape:Colorless to white to yellow to orange to brown, Fused solid or clear liquid as meltMolecular weight:177.223-Acetylphenyl isothiocyanate
CAS:Formula:C9H7NOSPurity:98.0%Color and Shape:Low Melting SolidMolecular weight:177.22
