CAS 3125-71-1: 3-Acetylphenyl isothiocyanate
Description:3-Acetylphenyl isothiocyanate is an organic compound characterized by the presence of both an isothiocyanate functional group and an acetyl group attached to a phenyl ring. Its molecular structure features a phenyl ring substituted at the 3-position with an acetyl group and an isothiocyanate group, which is known for its reactivity and ability to form thiourea derivatives. This compound typically appears as a yellow to brown liquid and has a distinctive pungent odor, characteristic of isothiocyanates. It is soluble in organic solvents but has limited solubility in water. 3-Acetylphenyl isothiocyanate is of interest in various fields, including medicinal chemistry and agricultural science, due to its potential biological activities, including antimicrobial and anticancer properties. As with many isothiocyanates, it may exhibit toxicity, necessitating careful handling and appropriate safety measures during use. Its reactivity allows it to participate in various chemical reactions, making it a valuable intermediate in organic synthesis.
Formula:C9H7NOS
InChI:InChI=1/C9H7NOS/c1-7(11)8-3-2-4-9(5-8)10-6-12/h2-5H,1H3
- Synonyms:
- 3-Isothiocyanatoacetophenone
- 1-(3-Isothiocyanatophenyl)Ethanone
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Acetylphenyl isothiocyanate, 97% REF: 02-L10134CAS: 3125-71-1 | 97% | To inquire | Tue 29 Apr 25 |
 | 3-Acetylphenyl isothiocyanate REF: 10-F018153CAS: 3125-71-1 | 98.0% | 55.00 €~95.00 € | Tue 29 Apr 25 |
 | 3-ACETYLPHENYL ISOTHIOCYANATE REF: IN-DA003ITHCAS: 3125-71-1 | - - - | To inquire | Mon 05 May 25 |
 | 1-(3-Isothiocyanatophenyl)ethanone REF: 3D-FI114633CAS: 3125-71-1 | Min. 95% | - - - | Discontinued product |
3-Acetylphenyl isothiocyanate, 97%
Ref: 02-L10134
| 1g | 34.00 € | ||
| 5g | To inquire |
3-Acetylphenyl isothiocyanate
Ref: 10-F018153
| 1g | 55.00 € | ||
| 5g | 95.00 € |
1-(3-Isothiocyanatophenyl)ethanone
Ref: 3D-FI114633
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
