CAS 31250-06-3

4,7,13,18-Tetraoxa-1,10-diazabicyclo[8.5.5]eicosane

Description:

4,7,13,18-Tetraoxa-1,10-diazabicyclo[8.5.5]eicosane, with the CAS number 31250-06-3, is a bicyclic compound characterized by its unique structure that includes two nitrogen atoms and four oxygen atoms within its framework. This compound features a bicyclic arrangement, which contributes to its potential applications in various fields, including coordination chemistry and materials science. The presence of multiple oxygen atoms suggests that it may exhibit properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its reactivity and interaction with other chemical species. Additionally, the diazabicyclic structure may impart stability and specific geometric configurations that are advantageous in catalysis or as ligands in metal complexes. While specific physical properties such as melting point, boiling point, and solubility may vary, the compound's structural characteristics indicate potential utility in synthetic chemistry and the development of novel materials. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₄H₂₈N₂O₄

InChI: InChI=1S/C14H28N2O4/c1-7-17-9-3-16-4-10-18-8-2-15(1)5-11-19-13-14-20-12-6-16/h1-14H2

InChI key: InChIKey=LVNQVIZBPSRXAN-UHFFFAOYSA-N

SMILES: N12CCOCCOCCN(CCOCC1)CCOCC2

Synonyms:

• 4,7,13,18-Tetraoxa-1,10-diazabicyclo[8.5.5]eicosane
• Cryptand 2.1.1
• Cryptand 211
• Cryptate 211
• Cryptating agent 211
• Kryptofix 211
• 4,7,13,18-Tetraoxa-1,10-diazabicyclo(8.5.5)icosane

Cryptand 211

Controlled Product

CAS: 31250-06-3

Formula: C₁₄H₂₈N₂O₄

Color and Shape: Neat

Molecular weight: 288.383

Ref: TR-T206580