CAS 31250-80-3: 1-Benzyl-2,4,5-tribromo-1H-imidazole

Description:1-Benzyl-2,4,5-tribromo-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of three bromine substituents at the 2, 4, and 5 positions of the imidazole ring significantly influences its chemical properties, including increased reactivity and potential biological activity. The benzyl group attached to the nitrogen atom enhances the lipophilicity of the compound, which may affect its solubility in organic solvents. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications as a pharmaceutical agent or as a precursor in organic synthesis. Its brominated structure may also impart unique electronic properties, making it suitable for specific applications in electronic materials. Safety data should be consulted, as brominated compounds can exhibit toxicity and environmental persistence. Overall, 1-Benzyl-2,4,5-tribromo-1H-imidazole represents a versatile compound with significant implications in chemical research and application.

Formula:C₁₀H₇Br₃N₂

InChI:InChI=1/C10H7Br3N2/c11-8-9(12)15(10(13)14-8)6-7-4-2-1-3-5-7/h1-5H,6H2

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-Benzyl-2,4,5-tribromo-1H-imidazole REF: IN-DA007I2NCAS: 31250-80-3	95%	To inquire	Mon 21 Apr 25
1-Benzyl-2,4,5-tribromo-1H-imidazole REF: 54-OR10354CAS: 31250-80-3	- - -	To inquire	Mon 28 Apr 25
1-Benzyl-2,4,5-tribromo-1H-imidazole REF: 10-F213795CAS: 31250-80-3	95.0%	To inquire	Tue 29 Apr 25
1-Benzyl-2,4,5-tribromo-1H-imidazole REF: 3D-FB155707CAS: 31250-80-3	Min. 95%	- - -	Discontinued product