CAS 312505-97-8
:2-[5-(trifluoromethyl)isoxazol-3-yl]phenol
Description:
2-[5-(Trifluoromethyl)isoxazol-3-yl]phenol, with the CAS number 312505-97-8, is a chemical compound characterized by its unique structural features, including a phenolic group and an isoxazole ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the phenolic hydroxyl group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry and material science. The isoxazole moiety contributes to the compound's electronic properties, potentially affecting its interactions in various chemical environments. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability and altered solubility. Overall, 2-[5-(trifluoromethyl)isoxazol-3-yl]phenol is a compound that may exhibit diverse applications, particularly in pharmaceuticals and agrochemicals, due to its distinctive chemical structure and properties.
Formula:C10H6F3NO2
InChI:InChI=1/C10H6F3NO2/c11-10(12,13)9-5-7(14-16-9)6-3-1-2-4-8(6)15/h1-5,15H
InChI key:BYDNWVIKLHIWSM-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)c1cc(C(F)(F)F)on1)O
Synonyms:- 2-[5-(Trifluoromethyl)-1,2-oxazol-3-yl]phenol
- Phenol, 2-[5-(trifluoromethyl)-3-isoxazolyl]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery