CAS 31252-58-1
:4-benzylpiperidine-1-carboxamide
Description:
4-Benzylpiperidine-1-carboxamide is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a benzyl group attached to the fourth carbon of the piperidine ring and a carboxamide functional group at the first position. This configuration contributes to its unique chemical properties, including potential interactions with biological systems. The presence of the benzyl group enhances lipophilicity, which may influence its ability to cross biological membranes. As a carboxamide, it exhibits hydrogen bonding capabilities, which can affect its solubility and reactivity. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its CAS number, 31252-58-1, allows for easy identification in chemical databases. Overall, 4-benzylpiperidine-1-carboxamide is a versatile compound with characteristics that make it suitable for various research applications, particularly in the fields of drug development and organic synthesis.
Formula:C13H18N2O
InChI:InChI=1/C13H18N2O/c14-13(16)15-8-6-12(7-9-15)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,14,16)
SMILES:c1ccc(cc1)CC1CCN(CC1)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
