CAS 31255-47-7
:3-[2-(3-chlorophenyl)ethyl]pyridine 1-oxide
Description:
3-[2-(3-Chlorophenyl)ethyl]pyridine 1-oxide, with the CAS number 31255-47-7, is a chemical compound characterized by its pyridine ring structure substituted with a 3-chlorophenyl group and an ethyl chain. This compound features a nitrogen atom in the pyridine ring that is oxidized, resulting in the formation of a pyridine N-oxide, which can influence its reactivity and solubility. The presence of the chlorophenyl group may impart specific electronic properties, potentially affecting its biological activity and interaction with other molecules. Generally, compounds like this can exhibit a range of properties, including potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The chlorinated aromatic moiety can enhance lipophilicity, while the pyridine N-oxide functionality may contribute to hydrogen bonding and coordination with metal ions. Overall, the unique structural features of 3-[2-(3-chlorophenyl)ethyl]pyridine 1-oxide suggest diverse applications in various fields, including medicinal chemistry and materials science.
Formula:C13H12ClNO
InChI:InChI=1/C13H12ClNO/c14-13-5-1-3-11(9-13)6-7-12-4-2-8-15(16)10-12/h1-5,8-10H,6-7H2
SMILES:c1cc(CCc2cccn(=O)c2)cc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

