CAS 312624-13-8

chloro-[(3-chlorophenyl)methyl]zinc

Description:

Chloro-[(3-chlorophenyl)methyl]zinc, with the CAS number 312624-13-8, is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a 3-chlorobenzyl moiety. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents such as ether and THF, but insoluble in water. It is known for its reactivity, particularly in organic synthesis, where it can act as a nucleophile in various coupling reactions, including those involving carbon-carbon bond formation. The presence of the chlorophenyl group can influence its reactivity and selectivity in chemical transformations. As with many organometallic compounds, it should be handled with care due to its potential reactivity and toxicity. Proper safety protocols should be followed when working with this substance, including the use of personal protective equipment and working in a well-ventilated area or fume hood.

Formula: C₇H₆Cl₂Zn

InChI: InChI=1/C7H6Cl.ClH.Zn/c1-6-3-2-4-7(8)5-6;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6Cl2Zn/c8-7-3-1-2-6(4-7)5-10-9/h1-4H,5H2

InChI key: ICUOPRHOUZCMIM-UHFFFAOYSA-M

SMILES: C=C1C=CC=C([CH]1)Cl.Cl.[Zn]