CAS 312624-17-2

[[1,1′-Biphenyl]-2-ylmethyl]bromozinc

Description:

[[1,1′-Biphenyl]-2-ylmethyl]bromozinc, with the CAS number 312624-17-2, is an organozinc compound characterized by the presence of a bromine atom and a biphenyl moiety. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles due to the presence of the zinc atom, which can facilitate various chemical transformations. The biphenyl structure contributes to its stability and solubility in organic solvents, making it useful in synthetic organic chemistry, particularly in cross-coupling reactions. Additionally, the bromine atom serves as a leaving group, enhancing its utility in reactions like nucleophilic substitution. The compound may also exhibit moderate toxicity, common to many organozinc species, necessitating careful handling and storage. Overall, [[1,1′-Biphenyl]-2-ylmethyl]bromozinc is a valuable reagent in the synthesis of complex organic molecules, particularly in the development of pharmaceuticals and advanced materials.

Formula: C₁₃H₁₁BrZn

InChI: InChI=1S/C13H11.BrH.Zn/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;;/h2-10H,1H2;1H;/q;;+1/p-1

InChI key: InChIKey=AYMXZVLUORYADV-UHFFFAOYSA-M

SMILES: C([Zn]Br)C1=C(C=CC=C1)C2=CC=CC=C2

Synonyms:

• [[1,1′-Biphenyl]-2-ylmethyl]bromozinc
• [(2-Phenylphenyl)methyl]zinc bromide
• [(Biphenyl-2-yl)methyl]zinc bromide
• Zinc, [[1,1′-biphenyl]-2-ylmethyl]bromo-