CAS 312692-95-8

(2,4-dimethylphenyl)-iodo-zinc

Description:

(2,4-Dimethylphenyl)-iodo-zinc, identified by its CAS number 312692-95-8, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo group and a 2,4-dimethylphenyl moiety. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and potential use in cross-coupling reactions, making it valuable in synthetic organic chemistry. The presence of the iodo group enhances its reactivity, allowing it to participate in various transformations, including nucleophilic substitutions and coupling reactions. The 2,4-dimethylphenyl group contributes to the compound's steric and electronic properties, influencing its reactivity and solubility in organic solvents. As with many organozinc compounds, it may be sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Overall, (2,4-dimethylphenyl)-iodo-zinc serves as a useful reagent in the synthesis of complex organic molecules, particularly in the field of medicinal chemistry and materials science.

Formula: C₈H₉IZn

InChI: InChI=1/C8H9.HI.Zn/c1-7-4-3-5-8(2)6-7;;/h3-4,6H,1-2H3;1H;/q;;+1/p-1/rC8H9IZn/c1-6-3-4-8(10-9)7(2)5-6/h3-5H,1-2H3

InChI key: CEBUOHBHZRLYGT-UHFFFAOYSA-M

SMILES: Cc1cccc(C)c1.I.[Zn]