CAS 312693-17-7

Chloro[(4-methoxyphenyl)methyl]zinc

Description:

Chloro[(4-methoxyphenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a 4-methoxyphenylmethyl group. This compound typically exhibits a tetrahedral geometry around the zinc center, which is common for organozinc species. The 4-methoxyphenylmethyl group contributes to its reactivity and solubility properties, making it useful in various organic synthesis applications, particularly in cross-coupling reactions and as a reagent in the formation of carbon-carbon bonds. The presence of the methoxy group enhances the electron density on the aromatic ring, potentially influencing its reactivity. Chloro[(4-methoxyphenyl)methyl]zinc is generally handled under inert atmospheres due to its sensitivity to moisture and air, which can lead to hydrolysis or oxidation. As with many organometallic compounds, safety precautions are essential when working with this substance, as it can be toxic and reactive. Its applications in synthetic organic chemistry highlight its importance in the development of complex molecular architectures.

Formula: C₈H₉ClOZn

InChI: InChI=1S/C8H9O.ClH.Zn/c1-7-3-5-8(9-2)6-4-7;;/h3-6H,1H2,2H3;1H;/q;;+1/p-1

InChI key: InChIKey=ULVBFPSIFSSTPM-UHFFFAOYSA-M

SMILES: C([Zn]Cl)C1=CC=C(OC)C=C1

Synonyms:

• 4-Methoxybenzylzinc chloride
• Chloro(4-methoxybenzyl)zinc
• Zinc, chloro[(4-methoxyphenyl)methyl]-
• Chloro[(4-methoxyphenyl)methyl]zinc