CAS 312693-21-3

Chloro[(4-methylphenyl)methyl]zinc

Description:

Chloro[(4-methylphenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom bonded to a chloro group and a 4-methylphenylmethyl group. This compound typically appears as a colorless to light yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly in organometallic chemistry, where it can act as a nucleophile in various coupling reactions, making it valuable in synthetic organic chemistry. The presence of the 4-methylphenyl group enhances its steric and electronic properties, influencing its reactivity and solubility in organic solvents. Chloro[(4-methylphenyl)methyl]zinc is sensitive to moisture and air, requiring careful handling under inert atmospheres to prevent decomposition or hydrolysis. Its applications may include use in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, where it can facilitate the formation of carbon-carbon bonds. As with many organometallic compounds, safety precautions are essential due to potential toxicity and reactivity.

Formula: C₈H₉ClZn

InChI: InChI=1S/C8H9.ClH.Zn/c1-7-3-5-8(2)6-4-7;;/h3-6H,1H2,2H3;1H;/q;;+1/p-1

InChI key: InChIKey=WWXZVYWATQAWGC-UHFFFAOYSA-M

SMILES: C([Zn]Cl)C1=CC=C(C)C=C1

Synonyms:

• (4-Methylbenzyl)zinc(II)chloride
• (4-Methylbenzyl)zinc chloride
• Chloro[(4-methylphenyl)methyl]zinc
• Zinc, chloro[(4-methylphenyl)methyl]-