
CAS 312693-63-3
:D-Glucopyranose, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-, monohydrate
Description:
D-Glucopyranose, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-, monohydrate, commonly referred to as a type of oligosaccharide, is a carbohydrate composed of multiple glucose units linked by glycosidic bonds. This compound features two α-D-glucopyranosyl units connected through a (1→4) linkage, indicating that the first glucose unit is linked to the second at the 4th carbon position. The presence of the monohydrate indicates that the compound includes one molecule of water per formula unit, which can influence its solubility and stability. Typically, such oligosaccharides are soluble in water and may exhibit sweet flavors, depending on their structure. They play significant roles in biological systems, serving as energy sources and participating in various metabolic processes. Additionally, they may have applications in food science and pharmaceuticals due to their functional properties. The CAS number 312693-63-3 uniquely identifies this specific chemical substance in chemical databases, facilitating research and regulatory processes.
Formula:C18H32O16·H2O
InChI:InChI=1S/C18H32O16.H2O/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24;/h4-29H,1-3H2;1H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17-,18-;/m1./s1
InChI key:InChIKey=HNKASWRMLBJLKJ-HNNWOXMSSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O)[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O.O
Synonyms:- D-Glucopyranose, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-, monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Maltotriose hydrate
CAS:<p>Maltotriose hydrate is a Chinese-made inhibitor analog that has shown promising anticancer properties. It has been shown to inhibit kinases, which are proteins involved in cell signaling pathways that regulate cell growth and division. This inhibition leads to apoptosis, or programmed cell death, in cancer cells. Maltotriose hydrate has been found in human urine and may have potential as a medicinal agent for the treatment of various types of tumors and cancers. Its ability to target cancer cells specifically makes it a promising candidate for further research into cancer treatments.</p>Formula:C18H34O17Purity:Min. 95%Molecular weight:522.5 g/mol
