CAS 31274-51-8
:2,4,6-Tribiphenyl-4-yl-1,3,5-triazine
Description:
2,4,6-Tribiphenyl-4-yl-1,3,5-triazine, with the CAS number 31274-51-8, is a chemical compound characterized by its complex structure, which includes a triazine ring substituted with three biphenyl groups. This compound typically exhibits properties such as high thermal stability and potential photophysical characteristics, making it of interest in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other optoelectronic applications. The presence of multiple biphenyl groups enhances its electron-accepting capabilities, which can influence its electronic properties and interactions with other materials. Additionally, the triazine moiety contributes to its aromaticity and stability. The compound may also display interesting solubility characteristics, depending on the solvent used, and can participate in various chemical reactions due to the presence of nitrogen atoms in the triazine ring. Overall, 2,4,6-Tribiphenyl-4-yl-1,3,5-triazine is a notable compound in the field of organic chemistry and materials science.
Formula:C39H27N3
InChI:InChI=1S/C39H27N3/c1-4-10-28(11-5-1)31-16-22-34(23-17-31)37-40-38(35-24-18-32(19-25-35)29-12-6-2-7-13-29)42-39(41-37)36-26-20-33(21-27-36)30-14-8-3-9-15-30/h1-27H
InChI key:InChIKey=CENPSTJGQOQKKW-UHFFFAOYSA-N
SMILES:C=1(N=C(N=C(N1)C2=CC=C(C=C2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7
Synonyms:- 2,4,6-Tris(p-biphenylyl)-s-triazine
- s-Triazine, 2,4,6-tri-4-biphenylyl-
- Tinosorb A 2B
- 1,3,5-Triazine, 2,4,6-tris([1,1′-biphenyl]-4-yl)-
- 2,4,6-Tris([1,1′-biphenyl]-4-yl)-1,3,5-triazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,4,6-Tris([1,1'-biphenyl]-4-yl)-1,3,5-triazine
CAS:Formula:C39H27N3Purity:96%Color and Shape:SolidMolecular weight:537.65182,4,6-Tri([1,1'-biphenyl]-4-yl)-1,3,5-triazine
CAS:2,4,6-Tri([1,1'-biphenyl]-4-yl)-1,3,5-triazinePurity:98%Molecular weight:537.65g/mol2,4,6-Tri([1,1'-biphenyl]-4-yl)-1,3,5-triazine
CAS:Formula:C39H27N3Purity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:537.67Tinosorb A 2B
CAS:Controlled ProductApplications Tinosorb A 2B used as a ultraviolet filter which enhances sun protection factor effectively with visible light and IR light-A protection.
References Masaki, Koichi. et al., Fragrance Journal. 45, 35-41(2017)Formula:C39H27N3Color and Shape:NeatMolecular weight:537.6522,4,6-Tri([1,1'-biphenyl]-4-yl)-1,3,5-triazine
CAS:2,4,6-Tri([1,1'-biphenyl]-4-yl)-1,3,5-triazine (TBP) is a benzoate. It is used as an excipient in pharmaceutical preparations. TBP has high values of radiation stability and chemical stability. TBP can be used to prepare a number of pharmaceuticals that are insoluble in water or other solvents due to its chelating ability. TBP is also used as a coating on the surface of zirconium oxide particles to increase the hydrophobicity and thus the stability of the particles. TBP is also used as a staining agent for fatty acids and as a photostabilizer for pharmaceutical preparations.Formula:C39H27N3Purity:Min. 95%Molecular weight:537.67 g/mol






