CAS 312748-79-1

{4-[(furan-2-ylcarbonyl)amino]phenoxy}acetic acid

Description:

{4-[(Furan-2-ylcarbonyl)amino]phenoxy}acetic acid, with the CAS number 312748-79-1, is a chemical compound characterized by its unique structural features, which include a furan ring and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, contributing to its potential as a bioactive molecule. The presence of the furan ring suggests possible reactivity and interactions with biological systems, while the phenoxy group may enhance solubility and stability. The compound is likely to be polar due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, the presence of the amino group may facilitate interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity and reactivity would require further investigation through experimental studies.

Formula: C₁₃H₁₁NO₅

InChI: InChI=1/C13H11NO5/c15-12(16)8-19-10-5-3-9(4-6-10)14-13(17)11-2-1-7-18-11/h1-7H,8H2,(H,14,17)(H,15,16)

SMILES: c1cc(C(=Nc2ccc(cc2)OCC(=O)O)O)oc1

Synonyms:

• [4-(2-Furoylamino)phenoxy]acetic acid
• Acetic acid, 2-[4-[(2-furanylcarbonyl)amino]phenoxy]-

[4-(2-furoylamino)phenoxy]acetic acid

CAS: 312748-79-1

Formula: C₁₃H₁₁NO₅

Purity: 95.0%

Molecular weight: 261.233

Ref: 10-F313835