CAS 312751-53-4

2-(1H-indol-3-yl)ethylthiourea

Description:

2-(1H-indol-3-yl)ethylthiourea, with the CAS number 312751-53-4, is an organic compound characterized by its unique structure that combines an indole moiety with an ethylthiourea group. This compound typically exhibits properties associated with both indole and thiourea derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the thiourea functional group. It is often studied for its pharmacological properties, including potential anti-cancer and anti-inflammatory effects. The compound is generally soluble in polar organic solvents, which facilitates its use in various chemical reactions and biological assays. Additionally, its structure allows for interactions with biological targets, making it of interest in medicinal chemistry. As with many thiourea derivatives, it may also exhibit reactivity towards electrophiles, which can be exploited in synthetic applications. Overall, 2-(1H-indol-3-yl)ethylthiourea represents a valuable compound in both research and potential therapeutic contexts.

Formula: C₁₁H₁₃N₃S

InChI: InChI=1/C11H13N3S/c12-11(15)13-6-5-8-7-14-10-4-2-1-3-9(8)10/h1-4,7,14H,5-6H2,(H3,12,13,15)

SMILES: c1ccc2c(c1)c(CCNC(=N)S)c[nH]2

Synonyms:

• 1-[2-(1H-Indol-3-yl)ethyl]thiourea
• Thiourea, N-[2-(1H-indol-3-yl)ethyl]-

[2-(1H-Indol-3-yl)-ethyl]-thiourea

CAS: 312751-53-4

Formula: C₁₁H₁₃N₃S

Purity: 97.0%

Molecular weight: 219.31

Ref: 10-F040676