CAS 312753-53-0
:5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride
Description:
5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes an indene core with ethyl substituents at the 5 and 6 positions and an amine functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical research. The presence of the amine group suggests potential basicity and reactivity, allowing for interactions with other chemical entities. Its structural features may impart specific biological activities, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and other physical properties would be relevant for practical applications, including formulation and stability studies. As with many amines, it may exhibit properties such as hydrogen bonding and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed due to the potential for biological activity and the presence of the hydrochloride salt.
Formula:C13H20ClN
InChI:InChI=1/C13H19N.ClH/c1-3-9-5-11-7-13(14)8-12(11)6-10(9)4-2;/h5-6,13H,3-4,7-8,14H2,1-2H3;1H
SMILES:CCc1cc2CC(Cc2cc1CC)N.Cl
Synonyms:- 5,6-Diethyl-2,3-dihydro-1H-inden-2-amine HCl
- 5,6-diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride (1:1)
- 5,6-Diethyl-2,3-Dihydro-1H-Inden-2-Amine
- 5,6-Diethyl-2,3-dihydro-1H-inden-2-amino Hydrochloride
- Indacaterol Intermediate-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride
CAS:Formula:C13H20ClNPurity:98%Color and Shape:SolidMolecular weight:225.7576Indacaterol Impurity 6 HCl
CAS:Formula:C13H19N·HClColor and Shape:White To Off-White SolidMolecular weight:189.30 36.465,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride
CAS:Controlled Product5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride is the salt form of a chemical compound that belongs to the group of acetylation agents. This chemical is highly soluble in water and is used as a reagent to acetylate amines. The industrial process for this compound begins with an acetone solution of 2,3-dihydroindene. Acetyl chloride reacts with 2,3-dithiobenzoyl chloride in an acid environment to produce 5,6-diethyl-2,3-dihydroindane. The product is treated with hydrogen chloride gas to produce 5,6-diethyl-2,3 dihydroindanamine hydrochloride. This compound has been shown to be toxic for aquatic life and can cause environmental pollution when released into the environment.Formula:C13H19N•HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:225.76 g/mol5,6-Diethyl-2,3-dihydro-1H-inden-2-amine Hydrochloride
CAS:Controlled ProductApplications 5,6-Diethyl-2,3-dihydro-1H-inden-2-amine Hydrochloride acts as a reagent in the synthetic preparation of quinolinone compounds and it’s formulations in combination with corticosteroids for treatment of airway disorder.
References Novartis A. G., et al.: PCT Int. Appl. (2002), WO 2002045703 A2 20020613Formula:C13H19N·HCiColor and Shape:WhiteMolecular weight:225.76





