CAS 3128-07-2
:6-Oxoheptanoic acid
Description:
6-Oxoheptanoic acid, with the CAS number 3128-07-2, is a carboxylic acid characterized by a seven-carbon chain with a ketone functional group at the sixth carbon position. This compound features a molecular structure that includes both a carboxylic acid (-COOH) and a carbonyl (C=O) group, which contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the ketone group enhances its acidity compared to straight-chain carboxylic acids, making it a useful intermediate in various chemical reactions, including the synthesis of pharmaceuticals and agrochemicals. Additionally, 6-oxoheptanoic acid may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its unique structure allows for potential applications in the development of specialty chemicals and materials. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)
InChI key:InChIKey=IZOQMUVIDMLRDC-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)CC(C)=O
Synonyms:- 6-Ketoheptanoic acid
- 6-Ketoheptanoic acid~6-Oxoheptanoic acid
- 6-Oxoenanthic acid
- 6-Oxoheptanoate
- 6-Oxoheptanoic acid
- Acetovaleric acid
- Heptanoic acid, 6-oxo-
- NSC 167591
- ε-Ketoheptanoic acid
- ε-Oxoenanthic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Acetylvaleric acid, 96%
CAS:<p>5-Acetylvaleric acid, is used as a reagent to synthesize new penicillins containing keto acids as side chains. It is also used to study the various metabolic pathways of 4-hydroxypentanoate and Levulinate. It is also used as an Pharmaceutical intermediate. This Thermo Scientific Chemicals brand pr</p>Formula:C7H12O3Purity:96%Color and Shape:White to pale cream, Crystals or powder or crystalline powder or fused solidMolecular weight:144.175-Acetylvaleric Acid
CAS:5-Acetylvaleric Acid is a long-chain fatty acid containing a carbonyl group, widely used in biochemical experiments and drug synthesis research.Formula:C7H12O3Color and Shape:SolidMolecular weight:144.176-Oxoheptanoic acid
CAS:<p>6-Oxoheptanoic acid</p>Formula:C7H12O3Purity:98%Color and Shape: white crystalline solidMolecular weight:144.17g/mol




