CymitQuimica logo

CAS 312904-49-7

:

1-(3-fluoropyridin-2-yl)methanamine dihydrochloride

Description:
1-(3-Fluoropyridin-2-yl)methanamine dihydrochloride is a chemical compound characterized by its structure, which includes a pyridine ring substituted with a fluorine atom and an amine group. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry and drug development. The presence of the fluorine atom can influence the compound's biological activity and pharmacokinetic properties, often enhancing lipophilicity and metabolic stability. As a primary amine, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's molecular interactions may be significant in the context of receptor binding or enzyme inhibition, making it of interest in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C6H9Cl2FN2
InChI:InChI=1/C6H7FN2.2ClH/c7-5-2-1-3-9-6(5)4-8;;/h1-3H,4,8H2;2*1H
InChI key:FUPNXLAWWSHZPJ-UHFFFAOYSA-N
SMILES:c1cc(c(CN)nc1)F.Cl.Cl
Synonyms:
  • 2-Aminomethyl-3-fluoropyridine dihydrochloride
  • 2-Pyridinemethanamine, 3-Fluoro-, Hydrochloride (1:2)
Found 4 products.