CymitQuimica logo

CAS 312904-87-3

:

ethyl (2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)acetate

Description:
Ethyl (2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)acetate, with the CAS number 312904-87-3, is a chemical compound that features a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by the presence of two carbonyl groups (dioxo) and an ethyl acetate moiety, contributing to its reactivity and potential applications in organic synthesis. The dihydropyrazine structure indicates that it has a saturated form of the pyrazine ring, which can influence its chemical behavior, such as its stability and reactivity in various conditions. Ethyl (2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)acetate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and other physical properties would depend on the specific conditions and purity of the compound. Overall, this substance represents a unique combination of functional groups that can be explored for various chemical reactions and applications in research.
Formula:C8H10N2O4
InChI:InChI=1/C8H10N2O4/c1-2-14-6(11)5-10-4-3-9-7(12)8(10)13/h3-4H,2,5H2,1H3,(H,9,12)
InChI key:YQIWYZDBGDASKD-UHFFFAOYSA-N
SMILES:CCOC(=O)Cn1cc[nH]c(=O)c1=O
Synonyms:
  • Ethyl (3-hydroxy-2-oxopyrazin-1(2H)-yl)acetate
Found 3 products.