
CAS 312905-00-3
:2-Pyridinemethanamine, 3-fluoro-4-methyl-, hydrochloride (1:2)
Description:
2-Pyridinemethanamine, 3-fluoro-4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a primary amine group (-NH2) attached to a pyridine ring, specifically at the 2-position, and includes a fluoro and methyl substituent at the 3 and 4 positions, respectively. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This substance is typically used in pharmaceutical research and development due to its potential biological activity. Its molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. The presence of the fluorine atom can influence the compound's lipophilicity and metabolic stability, which are critical factors in drug design. As with many amines, it may exhibit basic properties, and its hydrochloride form is often utilized in formulations to improve handling and dosing.
Formula:C7H9FN2·2ClH
InChI:InChI=1S/C7H9FN2.2ClH/c1-5-2-3-10-6(4-9)7(5)8;;/h2-3H,4,9H2,1H3;2*1H
InChI key:InChIKey=BHCWTPNZBVTHGG-UHFFFAOYSA-N
SMILES:C(N)C1=C(F)C(C)=CC=N1.Cl
Synonyms:- 2-Pyridinemethanamine, 3-fluoro-4-methyl-, hydrochloride (1:2)
- 2-Pyridinemethanamine, 3-fluoro-4-methyl-, dihydrochloride
- (3-Fluoro-4-methylpyridin-2-yl)methanamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(3-Fluoro-4-methylpyridin-2-yl)methanamine dihydrochloride
CAS:3-Fluoro-4-methylpyridin-2-yl)methanamine dihydrochloride (FMPD) is a template for the synthesis of new pyridine inhibitors of thrombin. The orally bioavailable FMPD has demonstrated anti-thrombotic activity in animal models and is being investigated as a potential therapeutic agent for the treatment or prevention of thrombosis. FMPD inhibits thrombin by binding to its active site, preventing it from cleaving fibrinogen and thereby inhibiting clot formation. This activity is increased by the presence of heparin, which facilitates the release of endogenous thrombin inhibitors, such as hirudin and antithrombin III.Formula:C7H11Cl2FN2Purity:Min. 95%Molecular weight:213.08 g/mol
