CAS 312915-90-5

3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide

Description:

3-Amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[2,3-b]pyridine core. This compound features multiple functional groups, including an amino group and a carboxamide, contributing to its potential reactivity and biological activity. The presence of ethyl and methyl substituents enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The thieno[2,3-b]pyridine framework is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for its practical use in research and development. Overall, 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide represents a unique scaffold for further investigation in drug discovery and development.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-4-7-5(2)8-9(13)10(11(14)16)17-12(8)15-6(7)3/h4,13H2,1-3H3,(H2,14,16)

SMILES: CCc1c(C)c2c(c(C(=O)N)sc2nc1C)N

3-AMINO-5-ETHYL-4,6-DIMETHYLTHIENO[2,3-B]PYRIDINE-2-CARBOXAMIDE

CAS: 312915-90-5

Formula: C₁₂H₁₅N₃OS

Purity: 95%

Molecular weight: 249.3320

Ref: IN-DA007HRW

3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide

CAS: 312915-90-5

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F313990