CymitQuimica logo

CAS 312922-10-4

:

3-Chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:
3-Chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core. This compound features a chloro substituent and a trifluoromethyl group, which contribute to its unique chemical reactivity and potential biological activity. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a carboxylic acid, it exhibits acidic properties, allowing for potential salt formation and reactivity in various chemical reactions. The trifluoromethyl group is known for imparting stability and altering the electronic properties of the molecule, which can be significant in medicinal chemistry. Overall, this compound may have applications in pharmaceuticals, particularly in the development of novel therapeutic agents, owing to its diverse functional groups and structural complexity. Further studies would be necessary to elucidate its specific biological activities and potential uses.
Formula:C16H11ClF3N3O4
InChI:InChI=1S/C16H11ClF3N3O4/c1-26-9-4-3-7(5-10(9)27-2)8-6-11(16(18,19)20)23-14(21-8)12(17)13(22-23)15(24)25/h3-6H,1-2H3,(H,24,25)
InChI key:InChIKey=FMHAKAVUCNNDMV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N2C(N=C(C1)C3=CC(OC)=C(OC)C=C3)=C(Cl)C(C(O)=O)=N2
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-
  • 3-Chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.