CAS 312922-20-6

Ethyl 4-amino-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-2-thioxo-5-thiazolecarboxylate

Description:

Ethyl 4-amino-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-2-thioxo-5-thiazolecarboxylate is a chemical compound characterized by its complex structure, which includes a thiazole ring, an ethyl ester group, and various substituents that contribute to its biological activity. The presence of the amino group and halogenated phenyl moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The thiazole ring, known for its role in various pharmacological activities, enhances the compound's reactivity and solubility properties. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure indicates potential for diverse applications in drug development, particularly in targeting specific enzymes or receptors. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound represents a class of thiazole derivatives that are valuable in the exploration of new therapeutic agents.

Formula: C₁₂H₁₀ClFN₂O₂S₂

InChI: InChI=1S/C12H10ClFN2O2S2/c1-2-18-11(17)9-10(15)16(12(19)20-9)6-3-4-8(14)7(13)5-6/h3-5H,2,15H2,1H3

InChI key: InChIKey=MJCFBPBKVBDVIP-UHFFFAOYSA-N

SMILES: NC=1N(C(=S)SC1C(OCC)=O)C2=CC(Cl)=C(F)C=C2

Synonyms:

• 5-Thiazolecarboxylic acid, 4-amino-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-2-thioxo-, ethyl ester
• Ethyl 4-amino-3-(3-chloro-4-fluorophenyl)-2,3-dihydro-2-thioxo-5-thiazolecarboxylate