CAS 31293-09-1
:2-(5-methylpyridin-2-yl)ethanethioamide
Description:
2-(5-Methylpyridin-2-yl)ethanethioamide, with the CAS number 31293-09-1, is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a methyl group and an ethanethioamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the thioamide group. The thioamide functional group can impart specific reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. Additionally, the presence of the pyridine ring may contribute to its biological activity, as many pyridine derivatives are known for their pharmacological properties. The compound's molecular interactions, stability, and reactivity can be influenced by factors such as pH and temperature. Overall, 2-(5-methylpyridin-2-yl)ethanethioamide is of interest in both synthetic organic chemistry and potential applications in medicinal chemistry.
Formula:C8H10N2S
InChI:InChI=1/C8H10N2S/c1-6-2-3-7(10-5-6)4-8(9)11/h2-3,5H,4H2,1H3,(H2,9,11)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Pyridineacetamide, 5-methylthio-
CAS:2-Pyridineacetamide, 5-methylthio- is a biochemical.Formula:C8H10N2SColor and Shape:SolidMolecular weight:166.24
